C25H33N3O5 — CID 59614091
N-butyl-2,4-dihydroxy-N-methyl-5-[5-[3-(methylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]benzamide (PubChem CID 59614091) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-butyl-2,4-dihydroxy-N-methyl-5-[5-[3-(methylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]benzamide.
| Compound Name | N-butyl-2,4-dihydroxy-N-methyl-5-[5-[3-(methylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]benzamide |
|---|---|
| PubChem CID | 59614091 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N-butyl-2,4-dihydroxy-N-methyl-5-[5-[3-(methylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]benzamide |
| SMILES | CCCCN(C)C(=O)c1cc(C(=O)N2Cc3ccc(OCCCNC)cc3C2)c(O)cc1O |
| InChI | InChI=1S/C25H33N3O5/c1-4-5-10-27(3)24(31)20-13-21(23(30)14-22(20)29)25(32)28-15-17-7-8-19(12-18(17)16-28)33-11-6-9-26-2/h7-8,12-14,26,29-30H,4-6,9-11,15-16H2,1-3H3 |
| InChIKey | KQDLNXKWXQWOAT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|