C21H15N3O2Pt — CID 135961556
2-[6-[2-(2-hydroxyphenyl)pyrimidin-4-yl]-2-pyridinyl]phenol;platinum (PubChem CID 135961556) has the molecular formula C21H15N3O2Pt and a molecular weight of 536.45 g/mol. Its IUPAC name is 2-[6-[2-(2-hydroxyphenyl)pyrimidin-4-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[2-(2-hydroxyphenyl)pyrimidin-4-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 135961556 |
| Molecular Formula | C21H15N3O2Pt |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 2-[6-[2-(2-hydroxyphenyl)pyrimidin-4-yl]-2-pyridinyl]phenol;platinum |
| SMILES | Oc1ccccc1-c1cccc(-c2ccnc(-c3ccccc3O)n2)n1.[Pt] |
| InChI | InChI=1S/C21H15N3O2.Pt/c25-19-10-3-1-6-14(19)16-8-5-9-17(23-16)18-12-13-22-21(24-18)15-7-2-4-11-20(15)26;/h1-13,25-26H; |
| InChIKey | NVKCHRIVIVQQEG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |