C18H17N5O6 — CID 135970115
5-[2-acetyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 135970115) has the molecular formula C18H17N5O6 and a molecular weight of 399.36 g/mol. Its IUPAC name is 5-[2-acetyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 5-[2-acetyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135970115 |
| Molecular Formula | C18H17N5O6 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 5-[2-acetyl-3-(3-nitrophenyl)-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c(C2=NN(C(C)=O)C(c3cccc([N+](=O)[O-])c3)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H17N5O6/c1-3-7-21-17(26)15(16(25)19-18(21)27)13-9-14(22(20-13)10(2)24)11-5-4-6-12(8-11)23(28)29/h3-6,8,14,26H,1,7,9H2,2H3,(H,19,25,27) |
| InChIKey | SNRVGNNWRVLBLR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|