C20H16FN5O2S — CID 135971097
3-(4-fluorophenyl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 135971097) has the molecular formula C20H16FN5O2S and a molecular weight of 409.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 135971097 |
| Molecular Formula | C20H16FN5O2S |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 3-(4-fluorophenyl)-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | CN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1c[nH]c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FN5O2S/c1-25(11-17-23-15-5-3-2-4-14(15)18(27)24-17)19(28)16-10-22-20(29)26(16)13-8-6-12(21)7-9-13/h2-10H,11H2,1H3,(H,22,29)(H,23,24,27) |
| InChIKey | AAZCPONFFUAJEO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|