C18H19ClN2O — CID 135971382
2-(4-ethylanilino)-4-methylquinolin-7-ol;hydrochloride (PubChem CID 135971382) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-(4-ethylanilino)-4-methylquinolin-7-ol;hydrochloride.
| Compound Name | 2-(4-ethylanilino)-4-methylquinolin-7-ol;hydrochloride |
|---|---|
| PubChem CID | 135971382 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(4-ethylanilino)-4-methylquinolin-7-ol;hydrochloride |
| SMILES | CCc1ccc(Nc2cc(C)c3ccc(O)cc3n2)cc1.Cl |
| InChI | InChI=1S/C18H18N2O.ClH/c1-3-13-4-6-14(7-5-13)19-18-10-12(2)16-9-8-15(21)11-17(16)20-18;/h4-11,21H,3H2,1-2H3,(H,19,20);1H |
| InChIKey | PMDDQXCWDHUJJW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |