C24H29N6O7S+ — CID 135972091
3-[8-[[(2S)-2-[benzenesulfonyl(methyl)amino]-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-3-yl]oxypropyl-(diaminomethylidene)azanium (PubChem CID 135972091) has the molecular formula C24H29N6O7S+ and a molecular weight of 545.60 g/mol. Its IUPAC name is 3-[8-[[(2S)-2-[benzenesulfonyl(methyl)amino]-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-3-yl]oxypropyl-(diaminomethylidene)azanium.
| Compound Name | 3-[8-[[(2S)-2-[benzenesulfonyl(methyl)amino]-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-3-yl]oxypropyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 135972091 |
| Molecular Formula | C24H29N6O7S+ |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 3-[8-[[(2S)-2-[benzenesulfonyl(methyl)amino]-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-3-yl]oxypropyl-(diaminomethylidene)azanium |
| SMILES | CN([C@@H](CNC(=O)c1cc(=O)n2cc(OCCC[NH+]=C(N)N)ccc2c1)C(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28N6O7S/c1-29(38(35,36)19-6-3-2-4-7-19)20(23(33)34)14-28-22(32)16-12-17-8-9-18(15-30(17)21(31)13-16)37-11-5-10-27-24(25)26/h2-4,6-9,12-13,15,20H,5,10-11,14H2,1H3,(H,28,32)(H,33,34)(H4,25,26,27)/p+1/t20-/m0/s1 |
| InChIKey | JEEZJDLPDKQFSG-FQEVSTJZSA-O |
| XLogP | -2.07 |
| TPSA | 200.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|