C25H31N6O7S+ — CID 135972090
5-[8-[[(2S)-2-(benzenesulfonamido)-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-2-yl]oxypentyl-(diaminomethylidene)azanium (PubChem CID 135972090) has the molecular formula C25H31N6O7S+ and a molecular weight of 559.63 g/mol. Its IUPAC name is 5-[8-[[(2S)-2-(benzenesulfonamido)-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-2-yl]oxypentyl-(diaminomethylidene)azanium.
| Compound Name | 5-[8-[[(2S)-2-(benzenesulfonamido)-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-2-yl]oxypentyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 135972090 |
| Molecular Formula | C25H31N6O7S+ |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 5-[8-[[(2S)-2-(benzenesulfonamido)-2-carboxyethyl]carbamoyl]-6-oxoquinolizin-2-yl]oxypentyl-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]CCCCCOc1ccn2c(=O)cc(C(=O)NC[C@H](NS(=O)(=O)c3ccccc3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C25H30N6O7S/c26-25(27)28-10-5-2-6-12-38-19-9-11-31-18(15-19)13-17(14-22(31)32)23(33)29-16-21(24(34)35)30-39(36,37)20-7-3-1-4-8-20/h1,3-4,7-9,11,13-15,21,30H,2,5-6,10,12,16H2,(H,29,33)(H,34,35)(H4,26,27,28)/p+1/t21-/m0/s1 |
| InChIKey | RLKNBBPJYIXHDM-NRFANRHFSA-O |
| XLogP | -1.64 |
| TPSA | 209.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|