C22H23BN4O6S — CID 59100116
CID 59100116 (PubChem CID 59100116) has the molecular formula C22H23BN4O6S and a molecular weight of 482.33 g/mol.
| Compound Name | CID 59100116 |
|---|---|
| PubChem CID | 59100116 |
| Molecular Formula | C22H23BN4O6S |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCCOc1ccc2cc(C(=O)NC[C@@H](C)NS(=O)(=O)c3ccccc3)cc(=O)n2c1 |
| InChI | InChI=1S/C22H23BN4O6S/c1-15(26-34(31,32)19-5-3-2-4-6-19)13-25-21(29)16-11-17-7-8-18(14-27(17)20(28)12-16)33-10-9-24-22(23)30/h2-8,11-12,14-15,26H,9-10,13H2,1H3,(H,24,30)(H,25,29)/t15-/m1/s1 |
| InChIKey | UYMMUZPXWYNJHR-OAHLLOKOSA-N |
| XLogP | 0.65 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|