C22H24Cl2N5O3+ — CID 135974478
2-[4-chloro-3-(1-hydroxypyridin-1-ium-4-yl)-5-methylpyrazol-1-yl]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 135974478) has the molecular formula C22H24Cl2N5O3+ and a molecular weight of 477.37 g/mol. Its IUPAC name is 2-[4-chloro-3-(1-hydroxypyridin-1-ium-4-yl)-5-methylpyrazol-1-yl]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-chloro-3-(1-hydroxypyridin-1-ium-4-yl)-5-methylpyrazol-1-yl]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 135974478 |
| Molecular Formula | C22H24Cl2N5O3+ |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-[4-chloro-3-(1-hydroxypyridin-1-ium-4-yl)-5-methylpyrazol-1-yl]-1-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1cc(N2CCN(C(=O)Cn3nc(-c4cc[n+](O)cc4)c(Cl)c3C)CC2)ccc1Cl |
| InChI | InChI=1S/C22H24Cl2N5O3/c1-15-21(24)22(16-5-7-28(31)8-6-16)25-29(15)14-20(30)27-11-9-26(10-12-27)17-3-4-18(23)19(13-17)32-2/h3-8,13,31H,9-12,14H2,1-2H3/q+1 |
| InChIKey | JAJPYHURRGLPMQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|