C20H20ClN5O2 — CID 58237741
CID 58237741 (PubChem CID 58237741) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol.
| Compound Name | CID 58237741 |
|---|---|
| PubChem CID | 58237741 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | — |
| SMILES | [CH]c1nn(CC(=O)N2CCN(c3ccc(Cl)c(OC)c3)CC2)c2ncccc12 |
| InChI | InChI=1S/C20H20ClN5O2/c1-14-16-4-3-7-22-20(16)26(23-14)13-19(27)25-10-8-24(9-11-25)15-5-6-17(21)18(12-15)28-2/h1,3-7,12H,8-11,13H2,2H3 |
| InChIKey | TXYQNCWCEZVECG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |