C25H25ClN4O3 — CID 135974922
(2R)-N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]piperidine-2-carboxamide (PubChem CID 135974922) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is (2R)-N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 135974922 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (2R)-N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C#Cc2cn(CCO)nc2-c2cc(Cl)ccc2O)cc1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C25H25ClN4O3/c26-19-8-11-23(32)21(15-19)24-18(16-30(29-24)13-14-31)7-4-17-5-9-20(10-6-17)28-25(33)22-3-1-2-12-27-22/h5-6,8-11,15-16,22,27,31-32H,1-3,12-14H2,(H,28,33)/t22-/m1/s1 |
| InChIKey | SSFKQLAVZOCDOF-JOCHJYFZSA-N |
| XLogP | 3.38 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|