C24H23ClN4O4 — CID 135975008
N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]morpholine-3-carboxamide (PubChem CID 135975008) has the molecular formula C24H23ClN4O4 and a molecular weight of 466.93 g/mol. Its IUPAC name is N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]morpholine-3-carboxamide.
| Compound Name | N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 135975008 |
| Molecular Formula | C24H23ClN4O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-[4-[2-[3-(5-chloro-2-hydroxyphenyl)-1-(2-hydroxyethyl)pyrazol-4-yl]ethynyl]phenyl]morpholine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C#Cc2cn(CCO)nc2-c2cc(Cl)ccc2O)cc1)C1COCCN1 |
| InChI | InChI=1S/C24H23ClN4O4/c25-18-5-8-22(31)20(13-18)23-17(14-29(28-23)10-11-30)4-1-16-2-6-19(7-3-16)27-24(32)21-15-33-12-9-26-21/h2-3,5-8,13-14,21,26,30-31H,9-12,15H2,(H,27,32) |
| InChIKey | RNERXZJAXSKPRX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|