C17H29N2O6S2- — CID 135975038
[(4S)-5-[(2R)-3-oxo-2-(propanoylamino)-3-(sulfidoamino)propyl]sulfanyl-4-propanoyloxypentyl] propanoate (PubChem CID 135975038) has the molecular formula C17H29N2O6S2- and a molecular weight of 421.56 g/mol. Its IUPAC name is [(4S)-5-[(2R)-3-oxo-2-(propanoylamino)-3-(sulfidoamino)propyl]sulfanyl-4-propanoyloxypentyl] propanoate.
| Compound Name | [(4S)-5-[(2R)-3-oxo-2-(propanoylamino)-3-(sulfidoamino)propyl]sulfanyl-4-propanoyloxypentyl] propanoate |
|---|---|
| PubChem CID | 135975038 |
| Molecular Formula | C17H29N2O6S2- |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [(4S)-5-[(2R)-3-oxo-2-(propanoylamino)-3-(sulfidoamino)propyl]sulfanyl-4-propanoyloxypentyl] propanoate |
| SMILES | CCC(=O)N[C@@H](CSC[C@H](CCCOC(=O)CC)OC(=O)CC)C(=O)N[S-] |
| InChI | InChI=1S/C17H29N2O6S2/c1-4-14(20)18-13(17(23)19-26)11-27-10-12(25-16(22)6-3)8-7-9-24-15(21)5-2/h12-13H,4-11H2,1-3H3,(H2-,18,19,20,23,26)/q-1/t12-,13-/m0/s1 |
| InChIKey | PJIHBXRNKQLDJN-STQMWFEESA-N |
| XLogP | 1.25 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|