C18H22N2O — CID 135975262
2-[(3,4-dimethylphenyl)methyl]-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one (PubChem CID 135975262) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methyl]-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one.
| Compound Name | 2-[(3,4-dimethylphenyl)methyl]-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135975262 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methyl]-3,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-one |
| SMILES | Cc1ccc(Cc2nc3c(c(=O)[nH]2)CCCCC3)cc1C |
| InChI | InChI=1S/C18H22N2O/c1-12-8-9-14(10-13(12)2)11-17-19-16-7-5-3-4-6-15(16)18(21)20-17/h8-10H,3-7,11H2,1-2H3,(H,19,20,21) |
| InChIKey | XUMLFDAFEGGECR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |