About chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol
chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol (PubChem CID 135975676) has the molecular formula C16H12ClN2OPt
and a molecular weight of 478.82 g/mol. Its IUPAC name is chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol.
Molecular Properties
| Compound Name | chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol |
| PubChem CID | 135975676 |
| Molecular Formula | C16H12ClN2OPt |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol |
| SMILES | Cl[Pt].Oc1ccccc1-c1cccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C16H12N2O.ClH.Pt/c19-16-10-2-1-6-12(16)13-8-5-9-15(18-13)14-7-3-4-11-17-14;;/h1-11,19H;1H;/q;;+1/p-1 |
| InChIKey | RKWYHKHKIIZIEF-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol?
The IUPAC name of chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol (CID 135975676) is chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol.
What is the SMILES notation for chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol?
The canonical SMILES for chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol is Cl[Pt].Oc1ccccc1-c1cccc(-c2ccccn2)n1.
What is the InChIKey of chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol?
The InChIKey is RKWYHKHKIIZIEF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H12N2O.ClH.Pt/c19-16-10-2-1-6-12(16)13-8-5-9-15(18-13)14-7-3-4-11-17-14;;/h1-11,19H;1H;/q;;+1/p-1.
What are the key properties of chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol?
chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol has a molecular weight of 478.82 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum;2-(6-pyridin-2-yl-2-pyridinyl)phenol is sourced from PubChem (CID 135975676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).