C30H20N2O2Pt — CID 135975688
2-[1-[3-(2-hydroxyphenyl)isoquinolin-1-yl]isoquinolin-3-yl]phenol;platinum (PubChem CID 135975688) has the molecular formula C30H20N2O2Pt and a molecular weight of 635.58 g/mol. Its IUPAC name is 2-[1-[3-(2-hydroxyphenyl)isoquinolin-1-yl]isoquinolin-3-yl]phenol;platinum.
| Compound Name | 2-[1-[3-(2-hydroxyphenyl)isoquinolin-1-yl]isoquinolin-3-yl]phenol;platinum |
|---|---|
| PubChem CID | 135975688 |
| Molecular Formula | C30H20N2O2Pt |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 2-[1-[3-(2-hydroxyphenyl)isoquinolin-1-yl]isoquinolin-3-yl]phenol;platinum |
| SMILES | Oc1ccccc1-c1cc2ccccc2c(-c2nc(-c3ccccc3O)cc3ccccc23)n1.[Pt] |
| InChI | InChI=1S/C30H20N2O2.Pt/c33-27-15-7-5-13-23(27)25-17-19-9-1-3-11-21(19)29(31-25)30-22-12-4-2-10-20(22)18-26(32-30)24-14-6-8-16-28(24)34;/h1-18,33-34H; |
| InChIKey | ZSLNKASVMOFLHP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |