About 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum
1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum (PubChem CID 135975694) has the molecular formula C30H20N2O2Pt
and a molecular weight of 635.58 g/mol. Its IUPAC name is 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum.
Molecular Properties
| Compound Name | 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum |
| PubChem CID | 135975694 |
| Molecular Formula | C30H20N2O2Pt |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum |
| SMILES | Oc1ccc2ccccc2c1-c1cccc(-c2cccc(-c3c(O)ccc4ccccc34)n2)n1.[Pt] |
| InChI | InChI=1S/C30H20N2O2.Pt/c33-27-17-15-19-7-1-3-9-21(19)29(27)25-13-5-11-23(31-25)24-12-6-14-26(32-24)30-22-10-4-2-8-20(22)16-18-28(30)34;/h1-18,33-34H; |
| InChIKey | NGXSQWJVMWZUKS-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum?
The IUPAC name of 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum (CID 135975694) is 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum.
What is the SMILES notation for 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum?
The canonical SMILES for 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum is Oc1ccc2ccccc2c1-c1cccc(-c2cccc(-c3c(O)ccc4ccccc34)n2)n1.[Pt].
What is the InChIKey of 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum?
The InChIKey is NGXSQWJVMWZUKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H20N2O2.Pt/c33-27-17-15-19-7-1-3-9-21(19)29(27)25-13-5-11-23(31-25)24-12-6-14-26(32-24)30-22-10-4-2-8-20(22)16-18-28(30)34;/h1-18,33-34H;.
What are the key properties of 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum?
1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum has a molecular weight of 635.58 g/mol, XLogP of 7.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[6-(2-hydroxynaphthalen-1-yl)-2-pyridinyl]-2-pyridinyl]naphthalen-2-ol;platinum is sourced from PubChem (CID 135975694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).