C16H15N5O3 — CID 135976631
4-[(4-methoxyphenyl)diazenyl]-5-(4-methoxy-3-pyridinyl)-1,2-dihydropyrazol-3-one (PubChem CID 135976631) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)diazenyl]-5-(4-methoxy-3-pyridinyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[(4-methoxyphenyl)diazenyl]-5-(4-methoxy-3-pyridinyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135976631 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-[(4-methoxyphenyl)diazenyl]-5-(4-methoxy-3-pyridinyl)-1,2-dihydropyrazol-3-one |
| SMILES | COc1ccc(/N=N/c2c(-c3cnccc3OC)[nH][nH]c2=O)cc1 |
| InChI | InChI=1S/C16H15N5O3/c1-23-11-5-3-10(4-6-11)18-20-15-14(19-21-16(15)22)12-9-17-8-7-13(12)24-2/h3-9H,1-2H3,(H2,19,21,22)/b20-18+ |
| InChIKey | LFXQDIJNEDMSCB-CZIZESTLSA-N |
| XLogP | 3.20 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|