C17H22N2S — CID 135977098
N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thia-1-azaspiro[4.4]nonan-2-imine (PubChem CID 135977098) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thia-1-azaspiro[4.4]nonan-2-imine.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thia-1-azaspiro[4.4]nonan-2-imine |
|---|---|
| PubChem CID | 135977098 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3-thia-1-azaspiro[4.4]nonan-2-imine |
| SMILES | c1ccc2c(c1)CCC(/N=C1/NC3(CCCC3)CS1)C2 |
| InChI | InChI=1S/C17H22N2S/c1-2-6-14-11-15(8-7-13(14)5-1)18-16-19-17(12-20-16)9-3-4-10-17/h1-2,5-6,15H,3-4,7-12H2,(H,18,19) |
| InChIKey | ZSCJROFDCAKFJR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|