C38H34N14NiO8 — CID 135978134
bis(N-(2,5-dimethoxyphenyl)imino-N'-[(5-nitro-2-pyridinyl)amino]pyridine-2-carboximidamide);nickel (PubChem CID 135978134) has the molecular formula C38H34N14NiO8 and a molecular weight of 873.47 g/mol. Its IUPAC name is bis(N-(2,5-dimethoxyphenyl)imino-N'-[(5-nitro-2-pyridinyl)amino]pyridine-2-carboximidamide);nickel.
| Compound Name | bis(N-(2,5-dimethoxyphenyl)imino-N'-[(5-nitro-2-pyridinyl)amino]pyridine-2-carboximidamide);nickel |
|---|---|
| PubChem CID | 135978134 |
| Molecular Formula | C38H34N14NiO8 |
| Molecular Weight | 873.47 g/mol |
| Exact Mass | 872.20 |
| IUPAC Name | bis(N-(2,5-dimethoxyphenyl)imino-N'-[(5-nitro-2-pyridinyl)amino]pyridine-2-carboximidamide);nickel |
| SMILES | COc1ccc(OC)c(/N=N/C(=N\Nc2ccc([N+](=O)[O-])cn2)c2ccccn2)c1.COc1ccc(OC)c(/N=N/C(=N\Nc2ccc([N+](=O)[O-])cn2)c2ccccn2)c1.[Ni] |
| InChI | InChI=1S/2C19H17N7O4.Ni/c2*1-29-14-7-8-17(30-2)16(11-14)22-24-19(15-5-3-4-10-20-15)25-23-18-9-6-13(12-21-18)26(27)28;/h2*3-12H,1-2H3,(H,21,23);/b2*24-22+,25-19-; |
| InChIKey | OJBCWTNWPDVLLN-KAVYEMDBSA-N |
| XLogP | 7.92 |
| TPSA | 272.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.47 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|