C18H16N2O3 — CID 135978831
methyl (2E)-2-diazo-3-oxo-4,4-diphenylpentanoate (PubChem CID 135978831) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is methyl (2E)-2-diazo-3-oxo-4,4-diphenylpentanoate.
| Compound Name | methyl (2E)-2-diazo-3-oxo-4,4-diphenylpentanoate |
|---|---|
| PubChem CID | 135978831 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl (2E)-2-diazo-3-oxo-4,4-diphenylpentanoate |
| SMILES | COC(=O)C(=[N+]=[N-])C(=O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3/c1-18(13-9-5-3-6-10-13,14-11-7-4-8-12-14)16(21)15(20-19)17(22)23-2/h3-12H,1-2H3 |
| InChIKey | RGCKVXRXWPULQG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|