C18H22N4O6 — CID 102278431
6-O-tert-butyl 1-O-methyl (4S)-2-diazo-3-oxo-4-(phenylcarbamoylamino)hexanedioate (PubChem CID 102278431) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-methyl (4S)-2-diazo-3-oxo-4-(phenylcarbamoylamino)hexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-methyl (4S)-2-diazo-3-oxo-4-(phenylcarbamoylamino)hexanedioate |
|---|---|
| PubChem CID | 102278431 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 6-O-tert-butyl 1-O-methyl (4S)-2-diazo-3-oxo-4-(phenylcarbamoylamino)hexanedioate |
| SMILES | COC(=O)C(=[N+]=[N-])C(=O)[C@H](CC(=O)OC(C)(C)C)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H22N4O6/c1-18(2,3)28-13(23)10-12(15(24)14(22-19)16(25)27-4)21-17(26)20-11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3,(H2,20,21,26)/t12-/m0/s1 |
| InChIKey | PNFDWULIXXWFNL-LBPRGKRZSA-N |
| XLogP | 1.32 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|