C30H29F3IrNO2- — CID 135979147
7-(3,3-dimethylbutyl)-3-(3H-naphthalen-3-id-2-yl)isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxypent-3-en-2-one (PubChem CID 135979147) has the molecular formula C30H29F3IrNO2- and a molecular weight of 684.78 g/mol. Its IUPAC name is 7-(3,3-dimethylbutyl)-3-(3H-naphthalen-3-id-2-yl)isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxypent-3-en-2-one.
| Compound Name | 7-(3,3-dimethylbutyl)-3-(3H-naphthalen-3-id-2-yl)isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 135979147 |
| Molecular Formula | C30H29F3IrNO2- |
| Molecular Weight | 684.78 g/mol |
| Exact Mass | 685.18 |
| IUPAC Name | 7-(3,3-dimethylbutyl)-3-(3H-naphthalen-3-id-2-yl)isoquinoline;iridium;(Z)-1,1,1-trifluoro-4-hydroxypent-3-en-2-one |
| SMILES | C/C(O)=C/C(=O)C(F)(F)F.CC(C)(C)CCc1ccc2cc(-c3[c-]cc4ccccc4c3)ncc2c1.[Ir] |
| InChI | InChI=1S/C25H24N.C5H5F3O2.Ir/c1-25(2,3)13-12-18-8-9-21-16-24(26-17-23(21)14-18)22-11-10-19-6-4-5-7-20(19)15-22;1-3(9)2-4(10)5(6,7)8;/h4-10,14-17H,12-13H2,1-3H3;2,9H,1H3;/q-1;;/b;3-2-; |
| InChIKey | DMQHJXCAMOCKGO-PMOSZIESSA-N |
| XLogP | 8.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.78 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|