C15H17F3IrN3- — CID 135979165
3-(3,3-dimethylbutan-2-yl)-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole;iridium (PubChem CID 135979165) has the molecular formula C15H17F3IrN3- and a molecular weight of 488.53 g/mol. Its IUPAC name is 3-(3,3-dimethylbutan-2-yl)-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole;iridium.
| Compound Name | 3-(3,3-dimethylbutan-2-yl)-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 135979165 |
| Molecular Formula | C15H17F3IrN3- |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 3-(3,3-dimethylbutan-2-yl)-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole;iridium |
| SMILES | CC(c1nnc(-c2[c-]cc(C(F)(F)F)cc2)[nH]1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C15H17F3N3.Ir/c1-9(14(2,3)4)12-19-13(21-20-12)10-5-7-11(8-6-10)15(16,17)18;/h5,7-9H,1-4H3,(H,19,20,21);/q-1; |
| InChIKey | SPYYHONGIPACOU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|