C10H7F3IrN3- — CID 135979197
iridium;3-methyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole (PubChem CID 135979197) has the molecular formula C10H7F3IrN3- and a molecular weight of 418.40 g/mol. Its IUPAC name is iridium;3-methyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole.
| Compound Name | iridium;3-methyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole |
|---|---|
| PubChem CID | 135979197 |
| Molecular Formula | C10H7F3IrN3- |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | iridium;3-methyl-5-[4-(trifluoromethyl)benzene-6-id-1-yl]-4H-1,2,4-triazole |
| SMILES | Cc1nnc(-c2[c-]cc(C(F)(F)F)cc2)[nH]1.[Ir] |
| InChI | InChI=1S/C10H7F3N3.Ir/c1-6-14-9(16-15-6)7-2-4-8(5-3-7)10(11,12)13;/h2,4-5H,1H3,(H,14,15,16);/q-1; |
| InChIKey | LREJLIGAFCNNRA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|