C10H7F3KN3 — CID 58163045
potassium 5-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1H-1,2,4-triazole (PubChem CID 58163045) has the molecular formula C10H7F3KN3 and a molecular weight of 265.28 g/mol. Its IUPAC name is potassium 5-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1H-1,2,4-triazole.
| Compound Name | potassium 5-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 58163045 |
| Molecular Formula | C10H7F3KN3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | potassium 5-methyl-3-[4-(trifluoromethyl)benzene-6-id-1-yl]-1H-1,2,4-triazole |
| SMILES | Cc1nc(-c2[c-]cc(C(F)(F)F)cc2)n[nH]1.[K+] |
| InChI | InChI=1S/C10H7F3N3.K/c1-6-14-9(16-15-6)7-2-4-8(5-3-7)10(11,12)13;/h2,4-5H,1H3,(H,14,15,16);/q-1;+1 |
| InChIKey | NQXXSRZIBOGTKP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|