C9H9F3N4 — CID 156683306
(2Z,4E)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine (PubChem CID 156683306) has the molecular formula C9H9F3N4 and a molecular weight of 230.19 g/mol. Its IUPAC name is (2Z,4E)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 156683306 |
| Molecular Formula | C9H9F3N4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (2Z,4E)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C=C(/C)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F3N4/c1-6(4-2-3-5-13)7-14-8(16-15-7)9(10,11)12/h2-5,13H,1H3,(H,14,15,16)/b3-2-,6-4+,13-5+ |
| InChIKey | OUYVREDCANXPJI-ZATWWTPMSA-N |
| XLogP | 2.43 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|