C9H12N4 — CID 144523482
(2E,4Z)-N-methyl-2-(1H-1,2,4-triazol-5-yl)hexa-2,4-dien-1-imine (PubChem CID 144523482) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2E,4Z)-N-methyl-2-(1H-1,2,4-triazol-5-yl)hexa-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-N-methyl-2-(1H-1,2,4-triazol-5-yl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144523482 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (2E,4Z)-N-methyl-2-(1H-1,2,4-triazol-5-yl)hexa-2,4-dien-1-imine |
| SMILES | C/C=C\C=C(/C=N/C)c1ncn[nH]1 |
| InChI | InChI=1S/C9H12N4/c1-3-4-5-8(6-10-2)9-11-7-12-13-9/h3-7H,1-2H3,(H,11,12,13)/b4-3-,8-5+,10-6+ |
| InChIKey | OEIVWQZBGZGMRI-ODMNQWKZSA-N |
| XLogP | 1.46 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|