C8H12N4 — CID 123450996
N-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 123450996) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is N-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | N-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123450996 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N-methyl-5-[(3E)-penta-1,3-dien-3-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | C=C/C(=C\C)c1nc(NC)n[nH]1 |
| InChI | InChI=1S/C8H12N4/c1-4-6(5-2)7-10-8(9-3)12-11-7/h4-5H,1H2,2-3H3,(H2,9,10,11,12)/b6-5+ |
| InChIKey | USWVTAYWCMCWDL-AATRIKPKSA-N |
| XLogP | 1.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|