C9H13N3 — CID 123876442
3-hexa-1,3-dien-2-yl-5-methyl-1H-1,2,4-triazole (PubChem CID 123876442) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-hexa-1,3-dien-2-yl-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-hexa-1,3-dien-2-yl-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 123876442 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-hexa-1,3-dien-2-yl-5-methyl-1H-1,2,4-triazole |
| SMILES | C=C(C=CCC)c1n[nH]c(C)n1 |
| InChI | InChI=1S/C9H13N3/c1-4-5-6-7(2)9-10-8(3)11-12-9/h5-6H,2,4H2,1,3H3,(H,10,11,12) |
| InChIKey | KGIYTLCONLSGKV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|