C12H16N3+ — CID 91237336
(8Z)-8-ethylidene-2,6,7-trimethyl-5-methylidene-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium (PubChem CID 91237336) has the molecular formula C12H16N3+ and a molecular weight of 202.28 g/mol. Its IUPAC name is (8Z)-8-ethylidene-2,6,7-trimethyl-5-methylidene-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium.
| Compound Name | (8Z)-8-ethylidene-2,6,7-trimethyl-5-methylidene-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium |
|---|---|
| PubChem CID | 91237336 |
| Molecular Formula | C12H16N3+ |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (8Z)-8-ethylidene-2,6,7-trimethyl-5-methylidene-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium |
| SMILES | C=c1c(C)c(C)/c(=C/C)c2nc(C)[nH][n+]12 |
| InChI | InChI=1S/C12H15N3/c1-6-11-8(3)7(2)9(4)15-12(11)13-10(5)14-15/h6H,4H2,1-3,5H3/p+1/b11-6- |
| InChIKey | SDVNOYCUJAEHNX-WDZFZDKYSA-O |
| XLogP | 0.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|