C13H19N3 — CID 123727216
5-tert-butyl-3-[(3Z)-hepta-1,3,5-trien-2-yl]-1H-1,2,4-triazole (PubChem CID 123727216) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 5-tert-butyl-3-[(3Z)-hepta-1,3,5-trien-2-yl]-1H-1,2,4-triazole.
| Compound Name | 5-tert-butyl-3-[(3Z)-hepta-1,3,5-trien-2-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 123727216 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5-tert-butyl-3-[(3Z)-hepta-1,3,5-trien-2-yl]-1H-1,2,4-triazole |
| SMILES | C=C(/C=C\C=CC)c1n[nH]c(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H19N3/c1-6-7-8-9-10(2)11-14-12(16-15-11)13(3,4)5/h6-9H,2H2,1,3-5H3,(H,14,15,16)/b7-6?,9-8- |
| InChIKey | PMUKWADRQCMNLQ-JZQWERLISA-N |
| XLogP | 3.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|