C10H15N3 — CID 123155201
3-(3-ethenylpent-3-enyl)-5-methyl-1H-1,2,4-triazole (PubChem CID 123155201) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-(3-ethenylpent-3-enyl)-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-(3-ethenylpent-3-enyl)-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 123155201 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3-(3-ethenylpent-3-enyl)-5-methyl-1H-1,2,4-triazole |
| SMILES | C=CC(=CC)CCc1n[nH]c(C)n1 |
| InChI | InChI=1S/C10H15N3/c1-4-9(5-2)6-7-10-11-8(3)12-13-10/h4-5H,1,6-7H2,2-3H3,(H,11,12,13) |
| InChIKey | VEONYNVEXSAUNS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|