C6H10N4 — CID 123608994
5-but-2-en-2-yl-1H-1,2,4-triazol-3-amine (PubChem CID 123608994) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 5-but-2-en-2-yl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-but-2-en-2-yl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123608994 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 5-but-2-en-2-yl-1H-1,2,4-triazol-3-amine |
| SMILES | CC=C(C)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C6H10N4/c1-3-4(2)5-8-6(7)10-9-5/h3H,1-2H3,(H3,7,8,9,10) |
| InChIKey | LPKQNEULFHMUQF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |