C5H8N4 — CID 56979604
5-[(E)-prop-1-enyl]-1H-1,2,4-triazol-3-amine (PubChem CID 56979604) has the molecular formula C5H8N4 and a molecular weight of 124.15 g/mol. Its IUPAC name is 5-[(E)-prop-1-enyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[(E)-prop-1-enyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 56979604 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 5-[(E)-prop-1-enyl]-1H-1,2,4-triazol-3-amine |
| SMILES | C/C=C/c1nc(N)n[nH]1 |
| InChI | InChI=1S/C5H8N4/c1-2-3-4-7-5(6)9-8-4/h2-3H,1H3,(H3,6,7,8,9)/b3-2+ |
| InChIKey | YOUQTWCWTGQPPP-NSCUHMNNSA-N |
| XLogP | 0.42 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |