C6H12Cl2N10 — CID 139147273
5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride (PubChem CID 139147273) has the molecular formula C6H12Cl2N10 and a molecular weight of 295.14 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride.
| Compound Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride |
|---|---|
| PubChem CID | 139147273 |
| Molecular Formula | C6H12Cl2N10 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride |
| SMILES | Nc1n[nH]c(/C=C/c2[nH]nc(N)[n+]2N)[n+]1N.[Cl-].[Cl-] |
| InChI | InChI=1S/C6H10N10.2ClH/c7-5-13-11-3(15(5)9)1-2-4-12-14-6(8)16(4)10;;/h1-2H,9-10H2,(H4,7,8,11,12,13,14);2*1H |
| InChIKey | QFIGCCNACIIMKX-UHFFFAOYSA-N |
| XLogP | -9.52 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | -9.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|