C8H14Cl2N10 — CID 139147275
5-[(1E,3E)-4-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)buta-1,3-dienyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride (PubChem CID 139147275) has the molecular formula C8H14Cl2N10 and a molecular weight of 321.18 g/mol. Its IUPAC name is 5-[(1E,3E)-4-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)buta-1,3-dienyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride.
| Compound Name | 5-[(1E,3E)-4-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)buta-1,3-dienyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride |
|---|---|
| PubChem CID | 139147275 |
| Molecular Formula | C8H14Cl2N10 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5-[(1E,3E)-4-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)buta-1,3-dienyl]-1H-1,2,4-triazol-4-ium-3,4-diamine dichloride |
| SMILES | Nc1n[nH]c(/C=C/C=C/c2[nH]nc(N)[n+]2N)[n+]1N.[Cl-].[Cl-] |
| InChI | InChI=1S/C8H12N10.2ClH/c9-7-15-13-5(17(7)11)3-1-2-4-6-14-16-8(10)18(6)12;;/h1-4H,11-12H2,(H4,9,10,13,14,15,16);2*1H |
| InChIKey | WHXOIRCLTVLVFN-UHFFFAOYSA-N |
| XLogP | -8.97 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | -8.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|