C9H15N3 — CID 144691260
3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole;ethane (PubChem CID 144691260) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole;ethane.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 144691260 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole;ethane |
| SMILES | C=C/C=C\c1n[nH]c(C)n1.CC |
| InChI | InChI=1S/C7H9N3.C2H6/c1-3-4-5-7-8-6(2)9-10-7;1-2/h3-5H,1H2,2H3,(H,8,9,10);1-2H3/b5-4-; |
| InChIKey | MMRFOQHSCALFBF-MKWAYWHRSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|