C6H12N10O4S — CID 139170755
5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine sulfate (PubChem CID 139170755) has the molecular formula C6H12N10O4S and a molecular weight of 320.30 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine sulfate.
| Compound Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine sulfate |
|---|---|
| PubChem CID | 139170755 |
| Molecular Formula | C6H12N10O4S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine sulfate |
| SMILES | Nc1n[nH]c(/C=C/c2[nH]nc(N)[n+]2N)[n+]1N.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C6H10N10.H2O4S/c7-5-13-11-3(15(5)9)1-2-4-12-14-6(8)16(4)10;1-5(2,3)4/h1-2H,9-10H2,(H4,7,8,11,12,13,14);(H2,1,2,3,4) |
| InChIKey | SNHNNYKBMLQAFI-UHFFFAOYSA-N |
| XLogP | -4.87 |
| TPSA | 249.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|