C6H10N10 — CID 102444115
5-[(E)-2-(4,5-diamino-1,2,4-triazol-3-yl)ethenyl]-1,2,4-triazole-3,4-diamine (PubChem CID 102444115) has the molecular formula C6H10N10 and a molecular weight of 222.22 g/mol. Its IUPAC name is 5-[(E)-2-(4,5-diamino-1,2,4-triazol-3-yl)ethenyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(E)-2-(4,5-diamino-1,2,4-triazol-3-yl)ethenyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 102444115 |
| Molecular Formula | C6H10N10 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 5-[(E)-2-(4,5-diamino-1,2,4-triazol-3-yl)ethenyl]-1,2,4-triazole-3,4-diamine |
| SMILES | Nc1nnc(/C=C/c2nnc(N)n2N)n1N |
| InChI | InChI=1S/C6H10N10/c7-5-13-11-3(15(5)9)1-2-4-12-14-6(8)16(4)10/h1-2H,9-10H2,(H2,7,13)(H2,8,14)/b2-1+ |
| InChIKey | BUWZCIGXSGXDHZ-OWOJBTEDSA-N |
| XLogP | -2.37 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |