C6H12Cl2N10O8 — CID 139170753
5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine diperchlorate (PubChem CID 139170753) has the molecular formula C6H12Cl2N10O8 and a molecular weight of 423.13 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine diperchlorate.
| Compound Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine diperchlorate |
|---|---|
| PubChem CID | 139170753 |
| Molecular Formula | C6H12Cl2N10O8 |
| Molecular Weight | 423.13 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1H-1,2,4-triazol-4-ium-3,4-diamine diperchlorate |
| SMILES | Nc1n[nH]c(/C=C/c2[nH]nc(N)[n+]2N)[n+]1N.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C6H10N10.2ClHO4/c7-5-13-11-3(15(5)9)1-2-4-12-14-6(8)16(4)10;2*2-1(3,4)5/h1-2H,9-10H2,(H4,7,8,11,12,13,14);2*(H,2,3,4,5) |
| InChIKey | JSHSVZKYAVHVDZ-UHFFFAOYSA-N |
| XLogP | -13.04 |
| TPSA | 353.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.13 |
| LogP ≤ 5 | -13.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|