C6H11N10+ — CID 139170752
5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine (PubChem CID 139170752) has the molecular formula C6H11N10+ and a molecular weight of 223.22 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 139170752 |
| Molecular Formula | C6H11N10+ |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 5-[(E)-2-(3,4-diamino-1H-1,2,4-triazol-4-ium-5-yl)ethenyl]-1,2,4-triazole-3,4-diamine |
| SMILES | Nc1nnc(/C=C/c2[nH]nc(N)[n+]2N)n1N |
| InChI | InChI=1S/C6H10N10/c7-5-13-11-3(15(5)9)1-2-4-12-14-6(8)16(4)10/h1-2H,9-10H2,(H4,7,8,11,12,13,14)/p+1 |
| InChIKey | ULQFYXHLGGUSSI-UHFFFAOYSA-O |
| XLogP | -2.95 |
| TPSA | 167.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|