C8H12N10 — CID 102444116
5-[(1E,3E)-4-(4,5-diamino-1,2,4-triazol-3-yl)buta-1,3-dienyl]-1,2,4-triazole-3,4-diamine (PubChem CID 102444116) has the molecular formula C8H12N10 and a molecular weight of 248.25 g/mol. Its IUPAC name is 5-[(1E,3E)-4-(4,5-diamino-1,2,4-triazol-3-yl)buta-1,3-dienyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(1E,3E)-4-(4,5-diamino-1,2,4-triazol-3-yl)buta-1,3-dienyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 102444116 |
| Molecular Formula | C8H12N10 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 5-[(1E,3E)-4-(4,5-diamino-1,2,4-triazol-3-yl)buta-1,3-dienyl]-1,2,4-triazole-3,4-diamine |
| SMILES | Nc1nnc(/C=C/C=C/c2nnc(N)n2N)n1N |
| InChI | InChI=1S/C8H12N10/c9-7-15-13-5(17(7)11)3-1-2-4-6-14-16-8(10)18(6)12/h1-4H,11-12H2,(H2,9,15)(H2,10,16)/b3-1+,4-2+ |
| InChIKey | XBVFYVDDIVLSRL-ZPUQHVIOSA-N |
| XLogP | -1.81 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|