About (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine
(Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine (PubChem CID 59967520) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine.
Analyze (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine?
The IUPAC name of (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine (CID 59967520) is (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine.
What is the SMILES notation for (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine?
The canonical SMILES for (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine is Cc1nc(/C=C\N)n[nH]1.
What is the InChIKey of (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine?
The InChIKey is GGYVHQGQAPMFNU-IHWYPQMZSA-N. The full InChI is InChI=1S/C5H8N4/c1-4-7-5(2-3-6)9-8-4/h2-3H,6H2,1H3,(H,7,8,9)/b3-2-.
What are the key properties of (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine?
(Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine has a molecular weight of 124.15 g/mol, XLogP of 0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethenamine is sourced from PubChem (CID 59967520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).