C9H20N6 — CID 142961689
ethane;(E)-N-(methyldiazenyl)prop-1-en-1-amine;5-methyl-1H-1,2,4-triazole (PubChem CID 142961689) has the molecular formula C9H20N6 and a molecular weight of 212.30 g/mol. Its IUPAC name is ethane;(E)-N-(methyldiazenyl)prop-1-en-1-amine;5-methyl-1H-1,2,4-triazole.
| Compound Name | ethane;(E)-N-(methyldiazenyl)prop-1-en-1-amine;5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 142961689 |
| Molecular Formula | C9H20N6 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | ethane;(E)-N-(methyldiazenyl)prop-1-en-1-amine;5-methyl-1H-1,2,4-triazole |
| SMILES | C/C=C/N/N=N/C.CC.Cc1ncn[nH]1 |
| InChI | InChI=1S/C4H9N3.C3H5N3.C2H6/c1-3-4-6-7-5-2;1-3-4-2-5-6-3;1-2/h3-4H,1-2H3,(H,5,6);2H,1H3,(H,4,5,6);1-2H3/b4-3+;; |
| InChIKey | NWICPMNQRVENNO-CZEFNJPISA-N |
| XLogP | 2.25 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|