C6H8N4 — CID 145064529
[2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]methanimine (PubChem CID 145064529) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is [2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]methanimine.
| Compound Name | [2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]methanimine |
|---|---|
| PubChem CID | 145064529 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | [2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]methanimine |
| SMILES | [H]/N=C/c1ncnn1/C=C\C |
| InChI | InChI=1S/C6H8N4/c1-2-3-10-6(4-7)8-5-9-10/h2-5,7H,1H3/b3-2-,7-4+ |
| InChIKey | XZOKKMUBRWYEJR-UDJLOATDSA-N |
| XLogP | 0.77 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|