C11H24N4 — CID 145064559
N,3-bis(ethenyl)-1,2,4-triazol-4-amine;ethane;methane (PubChem CID 145064559) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is N,3-bis(ethenyl)-1,2,4-triazol-4-amine;ethane;methane.
| Compound Name | N,3-bis(ethenyl)-1,2,4-triazol-4-amine;ethane;methane |
|---|---|
| PubChem CID | 145064559 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | N,3-bis(ethenyl)-1,2,4-triazol-4-amine;ethane;methane |
| SMILES | C.C=CNn1cnnc1C=C.CC.CC |
| InChI | InChI=1S/C6H8N4.2C2H6.CH4/c1-3-6-9-7-5-10(6)8-4-2;2*1-2;/h3-5,8H,1-2H2;2*1-2H3;1H4 |
| InChIKey | ISMNBEJMBVLCRN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |