About ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole
ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole (PubChem CID 142933455) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole.
Analyze ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole?
The IUPAC name of ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole (CID 142933455) is ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole.
What is the SMILES notation for ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole?
The canonical SMILES for ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole is C=Cn1ncnc1/C=C\C.CC.
What is the InChIKey of ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole?
The InChIKey is BKSPVPVDDQFVKR-FBZPGIPVSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c1-3-5-7-8-6-9-10(7)4-2;1-2/h3-6H,2H2,1H3;1-2H3/b5-3-;.
What are the key properties of ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole?
ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole has a molecular weight of 165.24 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-5-[(Z)-prop-1-enyl]-1,2,4-triazole is sourced from PubChem (CID 142933455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).