C10H17N3 — CID 143195747
3,4-bis(ethenyl)-1,2,4-triazole;ethane;ethene (PubChem CID 143195747) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-1,2,4-triazole;ethane;ethene.
| Compound Name | 3,4-bis(ethenyl)-1,2,4-triazole;ethane;ethene |
|---|---|
| PubChem CID | 143195747 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3,4-bis(ethenyl)-1,2,4-triazole;ethane;ethene |
| SMILES | C=C.C=Cc1nncn1C=C.CC |
| InChI | InChI=1S/C6H7N3.C2H6.C2H4/c1-3-6-8-7-5-9(6)4-2;2*1-2/h3-5H,1-2H2;1-2H3;1-2H2 |
| InChIKey | VOOMDTMYLTYOJP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|