C9H20N4 — CID 145064597
ethane;3-ethenyl-N-methyl-1,2,4-triazol-4-amine (PubChem CID 145064597) has the molecular formula C9H20N4 and a molecular weight of 184.29 g/mol. Its IUPAC name is ethane;3-ethenyl-N-methyl-1,2,4-triazol-4-amine.
| Compound Name | ethane;3-ethenyl-N-methyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 145064597 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | ethane;3-ethenyl-N-methyl-1,2,4-triazol-4-amine |
| SMILES | C=Cc1nncn1NC.CC.CC |
| InChI | InChI=1S/C5H8N4.2C2H6/c1-3-5-8-7-4-9(5)6-2;2*1-2/h3-4,6H,1H2,2H3;2*1-2H3 |
| InChIKey | UFUWMNXXZLIOAT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |